N-[2-(2,4,6-trichlorophenoxy)ethyl]propylamine
Catalog No: FT-0648685
CAS No: 67747-01-7
- Chemical Name: N-[2-(2,4,6-trichlorophenoxy)ethyl]propylamine
- Molecular Formula: C11H14Cl3NO
- Molecular Weight: 282.6
- InChI Key: CLFQSOIBYICELN-UHFFFAOYSA-N
- InChI: InChI=1S/C11H14Cl3NO/c1-2-3-15-4-5-16-11-9(13)6-8(12)7-10(11)14/h6-7,15H,2-5H2,1H3
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 282.59400 |
| Density: | 1.26g/cm3 |
| CAS: | 67747-01-7 |
| Bolling_Point: | 361.1ºC at 760 mmHg |
| Product_Name: | N-[2-(2,4,6-trichlorophenoxy)ethyl]propan-1-amine |
| Melting_Point: | N/A |
| Flash_Point: | 172.2ºC |
| MF: | C11H14Cl3NO |
| Density: | 1.26g/cm3 |
|---|---|
| LogP: | 4.41610 |
| Flash_Point: | 172.2ºC |
| Refractive_Index: | 1.534 |
| FW: | 282.59400 |
| PSA: | 21.26000 |
| MF: | C11H14Cl3NO |
| Bolling_Point: | 361.1ºC at 760 mmHg |
| Exact_Mass: | 281.01400 |
| Warning_Statement: | P301 + P312 + P330 |
|---|---|
| Safety_Statements: | H302-H413 |
| Symbol: | Warning |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2922299090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)